CAS 88578-24-9
:(E)-1-(4-chloro-2-methylphenyl)-2-(4-methoxyphenyl)diazene
Description:
(E)-1-(4-chloro-2-methylphenyl)-2-(4-methoxyphenyl)diazene, with the CAS number 88578-24-9, is an organic compound characterized by its diazene functional group, which features a nitrogen-nitrogen double bond. This compound exhibits a distinct E configuration, indicating that the substituents on either side of the diazene bond are positioned on opposite sides, which can influence its reactivity and physical properties. The presence of a 4-chloro-2-methylphenyl group and a 4-methoxyphenyl group contributes to its overall hydrophobic character and may affect its solubility in various solvents. The chlorinated and methoxy substituents can also impart unique electronic properties, potentially making the compound useful in various applications, including organic synthesis and materials science. Additionally, the compound's stability, reactivity, and potential biological activity can be influenced by the steric and electronic effects of these substituents. Overall, this compound represents a class of diazenes that may have interesting chemical behavior and applications in research and industry.
Formula:C14H13ClN2O
InChI:InChI=1/C14H13ClN2O/c1-10-9-11(15)3-8-14(10)17-16-12-4-6-13(18-2)7-5-12/h3-9H,1-2H3/b17-16+
Synonyms:- 2-Methyl-4-chloro-4'-methoxyazobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
