CymitQuimica logo

CAS 88589-46-2

:

3,4-bis(methylsulfanyl)selenophene

Description:
3,4-bis(methylsulfanyl)selenophene is an organoselenium compound characterized by the presence of a selenophene ring, which is a five-membered heterocyclic structure containing selenium. This compound features two methylthio (methylsulfanyl) groups attached to the 3 and 4 positions of the selenophene ring, enhancing its chemical reactivity and solubility in organic solvents. The presence of sulfur and selenium in its structure contributes to its unique electronic properties, making it of interest in materials science and organic electronics. It may exhibit interesting optical and electrical characteristics, potentially useful in applications such as organic semiconductors or photovoltaic devices. Additionally, the methylthio groups can influence the compound's stability and reactivity, allowing for further functionalization or interaction with other chemical species. As with many organoselenium compounds, it is essential to handle 3,4-bis(methylsulfanyl)selenophene with care due to potential toxicity associated with selenium-containing compounds.
Formula:C6H8S2Se
InChI:InChI=1/C6H8S2Se/c1-7-5-3-9-4-6(5)8-2/h3-4H,1-2H3
Synonyms:
  • selenophene, 3,4-bis(methylthio)-
  • 3,4-Bis(methylsulfanyl)selenophene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.