CAS 88594-81-4

5-(4-Cyanophenyl)-1,2-dihydro-6-methyl-2-oxo-3-pyridinecarboxamide

Description:

5-(4-Cyanophenyl)-1,2-dihydro-6-methyl-2-oxo-3-pyridinecarboxamide, with the CAS number 88594-81-4, is a chemical compound characterized by its pyridine ring structure, which is substituted with a cyanophenyl group and a carboxamide functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the cyanophenyl moiety may impart specific electronic properties, influencing its reactivity and interaction with biological targets. Additionally, the methyl and carbonyl groups contribute to its overall polarity and may affect its pharmacokinetic properties if considered for medicinal applications. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways. However, detailed studies on its biological activity, toxicity, and environmental impact would be necessary to fully understand its characteristics and potential uses.

Formula: C₁₄H₁₁N₃O₂

InChI: InChI=1S/C14H11N3O2/c1-8-11(6-12(13(16)18)14(19)17-8)10-4-2-9(7-15)3-5-10/h2-6H,1H3,(H2,16,18)(H,17,19)

InChI key: InChIKey=HBTBTUYZBBXODO-UHFFFAOYSA-N

SMILES: CC1=C(C=C(C(N)=O)C(=O)N1)C2=CC=C(C#N)C=C2

Synonyms:

• 5-(4-Cyanophenyl)-1,2-dihydro-6-methyl-2-oxo-3-pyridinecarboxamide
• 3-Pyridinecarboxamide, 5-(4-cyanophenyl)-1,2-dihydro-6-methyl-2-oxo-

3-Pyridinecarboxamide, 5-(4-cyanophenyl)-1,2-dihydro-6-methyl-2-oxo-

CAS: 88594-81-4

Formula: C₁₄H₁₁N₃O₂

Molecular weight: 253.256

Ref: IN-DA004B3E