CAS 885949-39-3
:Methyl α-(4-acetylphenoxy)benzeneacetate
Description:
Methyl α-(4-acetylphenoxy)benzeneacetate, identified by its CAS number 885949-39-3, is an organic compound characterized by its ester functional group, which is formed from the reaction of an alcohol and a carboxylic acid. This compound features a methyl ester group, an acetylphenoxy moiety, and a benzeneacetate structure, contributing to its potential applications in various fields, including pharmaceuticals and materials science. The presence of the acetyl group may impart specific reactivity and solubility characteristics, while the phenoxy group can enhance its interaction with biological systems. Methyl α-(4-acetylphenoxy)benzeneacetate is likely to exhibit moderate to high lipophilicity due to its aromatic components, which can influence its bioavailability and distribution in biological systems. Additionally, the compound may possess specific optical properties, making it of interest in the development of dyes or sensors. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks such as irritation or toxicity depending on exposure levels.
Formula:C17H16O4
InChI:InChI=1S/C17H16O4/c1-12(18)13-8-10-15(11-9-13)21-16(17(19)20-2)14-6-4-3-5-7-14/h3-11,16H,1-2H3
InChI key:InChIKey=DDMGUTFQAHUPNE-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(C(C)=O)C=C1)(C(OC)=O)C2=CC=CC=C2
Synonyms:- Methyl α-(4-acetylphenoxy)benzeneacetate
- Benzeneacetic acid, α-(4-acetylphenoxy)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2-(4-acetylphenoxy)-2-phenylacetate
CAS:<p>Methyl 2-(4-acetylphenoxy)-2-phenylacetate</p>Molecular weight:284.31g/mol
