CymitQuimica logo

CAS 885949-44-0

:

α-(4-Acetylphenoxy)benzeneacetic acid

Description:
α-(4-Acetylphenoxy)benzeneacetic acid, with the CAS number 885949-44-0, is an organic compound characterized by its aromatic structure and functional groups. It features a phenoxy group attached to a benzeneacetic acid moiety, which contributes to its potential as a pharmaceutical or agrochemical agent. The presence of the acetyl group enhances its reactivity and solubility in organic solvents. This compound may exhibit properties such as moderate to high melting and boiling points, depending on its molecular interactions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of anti-inflammatory or analgesic agents, due to the presence of the acetic acid functionality. Additionally, the compound's ability to form hydrogen bonds can influence its solubility and interaction with biological systems. As with many organic compounds, safety and handling precautions are essential, as it may pose risks if ingested or inhaled. Further studies would be necessary to fully elucidate its biological activity and potential applications.
Formula:C16H14O4
InChI:InChI=1S/C16H14O4/c1-11(17)12-7-9-14(10-8-12)20-15(16(18)19)13-5-3-2-4-6-13/h2-10,15H,1H3,(H,18,19)
InChI key:InChIKey=BMEHMYIRXJTQGE-UHFFFAOYSA-N
SMILES:C(OC1=CC=C(C(C)=O)C=C1)(C(O)=O)C2=CC=CC=C2
Synonyms:
  • Benzeneacetic acid, α-(4-acetylphenoxy)-
  • α-(4-Acetylphenoxy)benzeneacetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.