CAS 885949-45-1

5-[(4-Methylphenyl)sulfonyl]-2-phenyl-4(3H)-pyrimidinone

Description:

5-[(4-Methylphenyl)sulfonyl]-2-phenyl-4(3H)-pyrimidinone, identified by its CAS number 885949-45-1, is a synthetic organic compound characterized by its pyrimidinone core structure, which is a bicyclic compound featuring a pyrimidine ring fused to a carbonyl group. This compound exhibits a sulfonyl group attached to a para-methylphenyl moiety, contributing to its potential as a pharmacological agent. The presence of the sulfonyl group enhances its solubility and reactivity, making it suitable for various chemical reactions. Additionally, the phenyl groups provide hydrophobic characteristics, which can influence its biological activity and interactions with other molecules. The compound may exhibit properties such as anti-inflammatory or anticancer activities, although specific biological effects would depend on further empirical studies. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of targeted therapies. As with many synthetic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₇H₁₄N₂O₃S

InChI: InChI=1S/C17H14N2O3S/c1-12-7-9-14(10-8-12)23(21,22)15-11-18-16(19-17(15)20)13-5-3-2-4-6-13/h2-11H,1H3,(H,18,19,20)

InChI key: InChIKey=AOOKFOWJLVWRFH-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C=1C(=O)NC(=NC1)C2=CC=CC=C2)C3=CC=C(C)C=C3

Synonyms:

• 4(3H)-Pyrimidinone, 5-[(4-methylphenyl)sulfonyl]-2-phenyl-
• 5-[(4-Methylphenyl)sulfonyl]-2-phenyl-4(3H)-pyrimidinone
• 4(1H)-Pyrimidinone, 5-[(4-methylphenyl)sulfonyl]-2-phenyl-

4-Hydroxy-5-[(4-methylphenyl)sulphonyl]-2-phenylpyrimidine

CAS: 885949-45-1

4-Hydroxy-5-[(4-methylphenyl)sulphonyl]-2-phenylpyrimidine

Purity: 95%

Molecular weight: 326.37g/mol

Ref: 54-OR15424