CymitQuimica logo

CAS 885949-54-2

:

2,3,4,5,6-Pentafluorophenyl 2,3-dichlorobenzenesulfonate

Description:
2,3,4,5,6-Pentafluorophenyl 2,3-dichlorobenzenesulfonate is a synthetic organic compound characterized by its complex structure, which includes a pentafluorophenyl group and a dichlorobenzenesulfonate moiety. This compound is notable for its high degree of fluorination, which imparts unique chemical properties such as increased lipophilicity and thermal stability. The presence of multiple fluorine atoms enhances its reactivity in nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the dichlorobenzenesulfonate part of the molecule contributes to its potential as a sulfonate ester, which can be utilized in various chemical transformations. The compound is typically handled with care due to its potential toxicity and environmental impact, necessitating appropriate safety measures during its use in laboratory or industrial settings. Overall, 2,3,4,5,6-Pentafluorophenyl 2,3-dichlorobenzenesulfonate exemplifies the intricate interplay of structure and reactivity in fluorinated organic compounds.
Formula:C12H3Cl2F5O3S
InChI:InChI=1S/C12H3Cl2F5O3S/c13-4-2-1-3-5(6(4)14)23(20,21)22-12-10(18)8(16)7(15)9(17)11(12)19/h1-3H
InChI key:InChIKey=ZFWRVVWOUCBNLU-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)C1=C(Cl)C(Cl)=CC=C1)C2=C(F)C(F)=C(F)C(F)=C2F
Synonyms:
  • Benzenesulfonic acid, 2,3-dichloro-, 2,3,4,5,6-pentafluorophenyl ester
  • 2,3,4,5,6-Pentafluorophenyl 2,3-dichlorobenzenesulfonate
  • Benzenesulfonic acid, 2,3-dichloro-, pentafluorophenyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.