CAS 885949-57-5
:2,3,4,5,6-Pentafluorophenyl 2,4-dichlorobenzenesulfonate
Description:
2,3,4,5,6-Pentafluorophenyl 2,4-dichlorobenzenesulfonate is a chemical compound characterized by its complex structure, which includes a pentafluorophenyl group and a dichlorobenzenesulfonate moiety. This compound is notable for its high degree of fluorination, which enhances its chemical stability and lipophilicity, making it useful in various applications, including as a reagent in organic synthesis and in the development of pharmaceuticals. The presence of multiple chlorine atoms contributes to its reactivity and potential as an electrophile in nucleophilic substitution reactions. Additionally, the sulfonate group imparts solubility in polar solvents, facilitating its use in diverse chemical environments. Due to its fluorinated nature, this compound may exhibit unique electronic properties, influencing its behavior in chemical reactions. Safety considerations should be taken into account when handling this substance, as fluorinated compounds can pose environmental and health risks. Overall, 2,3,4,5,6-Pentafluorophenyl 2,4-dichlorobenzenesulfonate is a valuable compound in synthetic chemistry with distinct characteristics stemming from its functional groups.
Formula:C12H3Cl2F5O3S
InChI:InChI=1S/C12H3Cl2F5O3S/c13-4-1-2-6(5(14)3-4)23(20,21)22-12-10(18)8(16)7(15)9(17)11(12)19/h1-3H
InChI key:InChIKey=RMIBQQRVYAVHBB-UHFFFAOYSA-N
SMILES:O(S(=O)(=O)C1=C(Cl)C=C(Cl)C=C1)C2=C(F)C(F)=C(F)C(F)=C2F
Synonyms:- Benzenesulfonic acid, 2,4-dichloro-, 2,3,4,5,6-pentafluorophenyl ester
- Benzenesulfonic acid, 2,4-dichloro-, pentafluorophenyl ester
- 2,3,4,5,6-Pentafluorophenyl 2,4-dichlorobenzenesulfonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3,4,5,6-Pentafluorophenyl 2,4-dichlorobenzenesulphonate
CAS:2,3,4,5,6-Pentafluorophenyl 2,4-dichlorobenzenesulphonate
Molecular weight:393.11g/mol
