CAS 885949-60-0

6-Nitro-2-propylbenzoxazole

Description:

6-Nitro-2-propylbenzoxazole is an organic compound characterized by its benzoxazole structure, which consists of a fused benzene and oxazole ring. The presence of a nitro group at the 6-position and a propyl group at the 2-position contributes to its unique chemical properties. This compound is typically a yellow to orange solid, exhibiting moderate solubility in organic solvents. It may display fluorescence, making it of interest in various applications, including as a fluorescent probe or in materials science. The nitro group can influence the compound's reactivity, potentially participating in electrophilic substitution reactions. Additionally, the presence of the propyl group can affect the compound's steric and electronic properties, impacting its interactions with other molecules. As with many nitro-containing compounds, it is essential to handle 6-Nitro-2-propylbenzoxazole with care due to potential toxicity and environmental concerns. Overall, its unique structure and properties make it a subject of interest in both research and industrial applications.

Formula: C₁₀H₁₀N₂O₃

InChI: InChI=1S/C10H10N2O3/c1-2-3-10-11-8-5-4-7(12(13)14)6-9(8)15-10/h4-6H,2-3H2,1H3

InChI key: InChIKey=MQQPDIMYKKCHMW-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C2C(N=C(CCC)O2)=CC1

Synonyms:

• Benzoxazole, 6-nitro-2-propyl-
• 6-Nitro-2-propylbenzoxazole