CAS 885949-61-1
:6-Chloro-N-(2-hydroxyethyl)imidazo[1,2-a]pyridine-2-carboxamide
Description:
6-Chloro-N-(2-hydroxyethyl)imidazo[1,2-a]pyridine-2-carboxamide is a chemical compound characterized by its imidazo[1,2-a]pyridine core, which is a bicyclic structure containing both nitrogen and carbon atoms. The presence of a chloro group at the 6-position and a hydroxyethyl substituent at the nitrogen atom contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit polar characteristics due to the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The carboxamide functional group further increases its potential for interactions with biological targets, making it of interest in medicinal chemistry. Its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many heterocyclic compounds, its synthesis and characterization would involve standard organic chemistry techniques, and its properties would be assessed through various analytical methods to determine purity, stability, and biological efficacy.
Formula:C10H10ClN3O2
InChI:InChI=1S/C10H10ClN3O2/c11-7-1-2-9-13-8(6-14(9)5-7)10(16)12-3-4-15/h1-2,5-6,15H,3-4H2,(H,12,16)
InChI key:InChIKey=CTHJKOCOMSOFRO-UHFFFAOYSA-N
SMILES:C(NCCO)(=O)C=1N=C2N(C1)C=C(Cl)C=C2
Synonyms:- 6-Chloro-N-(2-hydroxyethyl)imidazo[1,2-a]pyridine-2-carboxamide
- Imidazo[1,2-a]pyridine-2-carboxamide, 6-chloro-N-(2-hydroxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.