CAS 885950-29-8

Methyl α-[(dimethylamino)methylene]-2-(methoxycarbonyl)benzeneacetate

Description:

Methyl α-[(dimethylamino)methylene]-2-(methoxycarbonyl)benzeneacetate, identified by its CAS number 885950-29-8, is a synthetic organic compound characterized by its complex structure, which includes a methoxycarbonyl group and a dimethylamino moiety. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is likely to be soluble in organic solvents due to the presence of hydrophobic aromatic and aliphatic groups, while its polar functional groups may impart some degree of solubility in polar solvents. The dimethylamino group suggests potential basicity, which could influence its reactivity and interactions in various chemical environments. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Proper safety protocols should be followed when working with this substance in laboratory settings.

Formula: C₁₄H₁₇NO₄

InChI: InChI=1S/C14H17NO4/c1-15(2)9-12(14(17)19-4)10-7-5-6-8-11(10)13(16)18-3/h5-9H,1-4H3

InChI key: InChIKey=NCSXFYKIZLLOIV-UHFFFAOYSA-N

SMILES: C(C(OC)=O)(=CN(C)C)C1=C(C(OC)=O)C=CC=C1

Synonyms:

• Methyl α-[(dimethylamino)methylene]-2-(methoxycarbonyl)benzeneacetate
• Benzeneacetic acid, α-[(dimethylamino)methylene]-2-(methoxycarbonyl)-, methyl ester