CAS 885950-30-1

2-Chloro-6-(3,4-dichlorophenyl)-3-pyridinecarbonitrile

Description:

2-Chloro-6-(3,4-dichlorophenyl)-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a cyano group and a chloro group, as well as a dichlorophenyl moiety. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its aromatic and halogenated nature. It is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting its polar and non-polar characteristics. The presence of chlorine atoms can influence its reactivity and stability, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the cyano group contributes to its potential as a building block in organic synthesis. Safety data sheets would indicate necessary precautions for handling, as halogenated compounds can pose environmental and health risks. Overall, 2-Chloro-6-(3,4-dichlorophenyl)-3-pyridinecarbonitrile is a compound of interest in both research and industrial contexts due to its unique structural features and potential applications.

Formula: C₁₂H₅Cl₃N₂

InChI: InChI=1S/C12H5Cl3N2/c13-9-3-1-7(5-10(9)14)11-4-2-8(6-16)12(15)17-11/h1-5H

InChI key: InChIKey=GWNZPDTZGHASFT-UHFFFAOYSA-N

SMILES: ClC1=NC(=CC=C1C#N)C2=CC(Cl)=C(Cl)C=C2

Synonyms:

• 3-Pyridinecarbonitrile, 2-chloro-6-(3,4-dichlorophenyl)-
• 2-Chloro-6-(3,4-dichlorophenyl)-3-pyridinecarbonitrile