CAS 885950-32-3

2,2,2-Trichloro-1-[4-(cyclohexylcarbonyl)-1H-pyrrol-2-yl]ethanone

Description:

2,2,2-Trichloro-1-[4-(cyclohexylcarbonyl)-1H-pyrrol-2-yl]ethanone, with CAS number 885950-32-3, is a synthetic organic compound characterized by its complex structure, which includes a trichloroacetyl group and a pyrrole moiety. This compound typically appears as a solid or crystalline substance and is notable for its potential applications in pharmaceuticals and agrochemicals due to its unique chemical properties. The presence of the trichloro group suggests it may exhibit significant reactivity, particularly in nucleophilic substitution reactions. The cyclohexylcarbonyl group contributes to the compound's lipophilicity, potentially influencing its solubility and bioavailability. Additionally, the pyrrole ring can participate in various chemical reactions, making this compound of interest in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,2,2-Trichloro-1-[4-(cyclohexylcarbonyl)-1H-pyrrol-2-yl]ethanone represents a versatile structure with implications in various chemical research fields.

Formula: C₁₃H₁₄Cl₃NO₂

InChI: InChI=1S/C13H14Cl3NO2/c14-13(15,16)12(19)10-6-9(7-17-10)11(18)8-4-2-1-3-5-8/h6-8,17H,1-5H2

InChI key: InChIKey=RPRAWHDYGHHKOM-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C(C(Cl)(Cl)Cl)=O)NC1)C2CCCCC2

Synonyms:

• Ethanone, 2,2,2-trichloro-1-[4-(cyclohexylcarbonyl)-1H-pyrrol-2-yl]-
• 2,2,2-Trichloro-1-[4-(cyclohexylcarbonyl)-1H-pyrrol-2-yl]ethanone
• 2,2,2-Trichloro-1-[4-(cyclohexanecarbonyl)-1H-pyrrol-2-yl]ethanone