CAS 885950-44-7
:4-Fluoro-4′-methoxy[1,1′-biphenyl]-3-carbonitrile
Description:
4-Fluoro-4′-methoxy[1,1′-biphenyl]-3-carbonitrile is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the para position of one phenyl ring and a methoxy group at the para position of the other ring contributes to its unique chemical properties. Additionally, the carbonitrile functional group (-C≡N) at the 3-position enhances its reactivity and polarity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure suggests potential applications in materials science and medicinal chemistry due to the electronic effects imparted by the fluorine and methoxy substituents. The compound's stability, solubility, and reactivity can vary based on the surrounding environment and conditions, making it a subject of interest for further research in various chemical applications.
Formula:C14H10FNO
InChI:InChI=1S/C14H10FNO/c1-17-13-5-2-10(3-6-13)11-4-7-14(15)12(8-11)9-16/h2-8H,1H3
InChI key:InChIKey=QLFLKGAHOYLYBV-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1F)C2=CC=C(OC)C=C2
Synonyms:- 2-Fluoro-5-(4-methoxyphenyl)benzonitrile
- [1,1′-Biphenyl]-3-carbonitrile, 4-fluoro-4′-methoxy-
- 4-Fluoro-4′-methoxy[1,1′-biphenyl]-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.