CAS 885950-94-7

3′,5′-Bis(trifluoromethyl)[1,1′-biphenyl]-3-sulfonyl chloride

Description:

3′,5′-Bis(trifluoromethyl)[1,1′-biphenyl]-3-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group and the presence of two trifluoromethyl groups attached to a biphenyl structure. This compound is typically a solid at room temperature and is known for its high reactivity, particularly due to the sulfonyl chloride moiety, which can readily participate in nucleophilic substitution reactions. The trifluoromethyl groups enhance the compound's lipophilicity and can influence its electronic properties, making it useful in various synthetic applications, including the development of pharmaceuticals and agrochemicals. Additionally, the presence of fluorine atoms often imparts unique characteristics such as increased stability and altered solubility in organic solvents. Safety precautions are necessary when handling this compound, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or other nucleophiles. Overall, this compound serves as a valuable intermediate in organic synthesis and materials science.

Formula: C₁₄H₇ClF₆O₂S

InChI: InChI=1S/C14H7ClF6O2S/c15-24(22,23)12-3-1-2-8(6-12)9-4-10(13(16,17)18)7-11(5-9)14(19,20)21/h1-7H

InChI key: InChIKey=MYMUROIBJCPGHV-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=C(C(F)(F)F)C1)C2=CC(S(Cl)(=O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-sulfonyl chloride, 3′,5′-bis(trifluoromethyl)-
• 3′,5′-Bis(trifluoromethyl)[1,1′-biphenyl]-3-sulfonyl chloride

3-[3,5-BIS(TRIFLUOROMETHYL)PHENYL]BENZENESULFONYL CHLORIDE

CAS: 885950-94-7

Formula: C₁₄H₇ClF₆O₂S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 388.71

Ref: 10-F306092