
CAS 885951-12-2
:Tetrahydro-N-methyl-4-(1-pyrrolidinylmethyl)-2H-pyran-4-amine
Description:
Tetrahydro-N-methyl-4-(1-pyrrolidinylmethyl)-2H-pyran-4-amine, identified by its CAS number 885951-12-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a tetrahydropyran ring and a pyrrolidine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. It may also demonstrate biological activity, making it of interest in pharmaceutical research. The presence of the pyrrolidine group suggests potential interactions with biological targets, possibly affecting neurotransmitter systems. Its molecular configuration can lead to specific stereochemical properties, impacting its reactivity and interaction with other molecules. As with many organic compounds, the stability and reactivity of Tetrahydro-N-methyl-4-(1-pyrrolidinylmethyl)-2H-pyran-4-amine can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of substances that may have applications in medicinal chemistry and drug development.
Formula:C11H22N2O
InChI:InChI=1S/C11H22N2O/c1-12-11(4-8-14-9-5-11)10-13-6-2-3-7-13/h12H,2-10H2,1H3
InChI key:InChIKey=QJDWQVFHADGEPI-UHFFFAOYSA-N
SMILES:C(C1(NC)CCOCC1)N2CCCC2
Synonyms:- Tetrahydro-N-methyl-4-(1-pyrrolidinylmethyl)-2H-pyran-4-amine
- 2H-Pyran-4-amine, tetrahydro-N-methyl-4-(1-pyrrolidinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2H-Pyran-4-amine,tetrahydro-N-methyl-4-(1-pyrrolidinylmethyl)-
CAS:Formula:C11H22N2OMolecular weight:198.3052
