CAS 885951-48-4

Methyl 5-chloro-6-(phenylthio)-3-pyridinecarboxylate

Description:

Methyl 5-chloro-6-(phenylthio)-3-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a methyl ester functional group, contributing to its reactivity and solubility in organic solvents. The presence of a chlorine atom at the 5-position and a phenylthio group at the 6-position of the pyridine ring introduces specific electronic and steric properties, which can influence its chemical behavior and potential applications. The phenylthio group enhances the compound's lipophilicity, making it suitable for various biological interactions. Methyl 5-chloro-6-(phenylthio)-3-pyridinecarboxylate may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its CAS number, 885951-48-4, allows for easy identification and retrieval of information regarding its synthesis, properties, and potential uses in scientific literature and databases. Overall, this compound represents a unique structure that could be explored for various chemical and biological applications.

Formula: C₁₃H₁₀ClNO₂S

InChI: InChI=1S/C13H10ClNO2S/c1-17-13(16)9-7-11(14)12(15-8-9)18-10-5-3-2-4-6-10/h2-8H,1H3

InChI key: InChIKey=SBVZEAMHMGSABW-UHFFFAOYSA-N

SMILES: S(C1=C(Cl)C=C(C(OC)=O)C=N1)C2=CC=CC=C2

Synonyms:

• 3-Pyridinecarboxylic acid, 5-chloro-6-(phenylthio)-, methyl ester
• Methyl 5-chloro-6-(phenylthio)-3-pyridinecarboxylate