
CAS 885951-49-5
:N-[(3-Methoxyphenyl)methoxy]hydrazinecarboxamide
Description:
N-[(3-Methoxyphenyl)methoxy]hydrazinecarboxamide, with the CAS number 885951-49-5, is a chemical compound characterized by its hydrazinecarboxamide functional group, which is linked to a methoxy-substituted phenyl moiety. This compound typically exhibits properties associated with both hydrazine derivatives and aromatic compounds, including potential biological activity. The presence of the methoxy groups suggests that it may have enhanced lipophilicity, which can influence its solubility and permeability in biological systems. Additionally, the hydrazine functional group may contribute to its reactivity, making it a candidate for various chemical reactions, including those involving nucleophilic attack. The compound's structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where hydrazine derivatives are often explored for their antitumor and antimicrobial properties. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C9H13N3O3
InChI:InChI=1S/C9H13N3O3/c1-14-8-4-2-3-7(5-8)6-15-12-9(13)11-10/h2-5H,6,10H2,1H3,(H2,11,12,13)
InChI key:InChIKey=YVYMSKZLKHDLED-UHFFFAOYSA-N
SMILES:C(ONC(NN)=O)C1=CC(OC)=CC=C1
Synonyms:- Hydrazinecarboxamide, N-[(3-methoxyphenyl)methoxy]-
- N-[(3-Methoxyphenyl)methoxy]hydrazinecarboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.