CAS 885951-53-1
:3-Amino-1H-pyrrole-2-carboxylic acid
Description:
3-Amino-1H-pyrrole-2-carboxylic acid, also known by its CAS number 885951-53-1, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features an amino group (-NH2) and a carboxylic acid group (-COOH) attached to the pyrrole ring, contributing to its properties as an amino acid derivative. The presence of these functional groups imparts both basic and acidic characteristics, allowing it to participate in various chemical reactions, including peptide bond formation. It is typically a white to off-white solid and is soluble in polar solvents due to its ability to form hydrogen bonds. 3-Amino-1H-pyrrole-2-carboxylic acid may have applications in pharmaceuticals, biochemistry, and materials science, particularly in the synthesis of biologically active compounds or as a building block in organic synthesis. Its reactivity and functional versatility make it a compound of interest in research and development within the chemical and pharmaceutical industries.
Formula:C5H6N2O2
InChI:InChI=1S/C5H6N2O2/c6-3-1-2-7-4(3)5(8)9/h1-2,7H,6H2,(H,8,9)
InChI key:InChIKey=MFBSDWRZRAMFAA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N)C=CN1
Synonyms:- 3-Amino-1H-pyrrole-2-carboxylic acid
- 1H-Pyrrole-2-carboxylic acid, 3-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
