CymitQuimica logo

CAS 885951-58-6

:

3-(4-Bromophenyl)-5-(hydroxymethyl)-2-oxazolidinone

Description:
3-(4-Bromophenyl)-5-(hydroxymethyl)-2-oxazolidinone is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of a bromophenyl group indicates that there is a bromine atom attached to a phenyl ring, contributing to the compound's potential reactivity and biological activity. The hydroxymethyl group suggests the presence of a hydroxyl (-OH) functional group attached to a methyl (-CH2-) moiety, which can influence the compound's solubility and interaction with biological systems. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals, due to the oxazolidinone core, which is known for its antibacterial properties. Additionally, the bromine substituent can enhance lipophilicity and affect the compound's pharmacokinetics. Overall, 3-(4-Bromophenyl)-5-(hydroxymethyl)-2-oxazolidinone is of interest for its potential applications in drug development and its unique structural features that may confer specific biological activities.
Formula:C10H10BrNO3
InChI:InChI=1S/C10H10BrNO3/c11-7-1-3-8(4-2-7)12-5-9(6-13)15-10(12)14/h1-4,9,13H,5-6H2
InChI key:InChIKey=YVHKIBHMVGVOTH-UHFFFAOYSA-N
SMILES:O=C1N(CC(CO)O1)C2=CC=C(Br)C=C2
Synonyms:
  • 2-Oxazolidinone, 3-(4-bromophenyl)-5-(hydroxymethyl)-
  • 3-(4-Bromophenyl)-5-(hydroxymethyl)-2-oxazolidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.