CAS 885952-21-6
:4-Benzyloxy-5-bromo-2-(1-pyrrolidinyl)pyrimidine
Description:
4-Benzyloxy-5-bromo-2-(1-pyrrolidinyl)pyrimidine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. The presence of a benzyloxy group at the 4-position and a bromo substituent at the 5-position contributes to its unique reactivity and potential biological activity. The 2-position features a pyrrolidinyl group, which enhances its lipophilicity and may influence its interaction with biological targets. This compound is typically used in medicinal chemistry and drug development, particularly in the context of designing inhibitors or modulators of specific biological pathways. Its structural features suggest potential applications in areas such as cancer research or neuropharmacology. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many synthetic organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H16BrN3O
InChI:InChI=1/C15H16BrN3O/c16-13-10-17-15(19-8-4-5-9-19)18-14(13)20-11-12-6-2-1-3-7-12/h1-3,6-7,10H,4-5,8-9,11H2
SMILES:c1ccc(cc1)COc1c(cnc(n1)N1CCCC1)Br
Synonyms:- 4-Benzyloxy-5-Bromo-2-Pyrrolidin-1-Yl-Pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
