CAS 885952-25-0
:5-Bromo-4-(phenylmethoxy)-N-(phenylmethyl)-2-pyrimidinamine
Description:
5-Bromo-4-(phenylmethoxy)-N-(phenylmethyl)-2-pyrimidinamine is a chemical compound characterized by its complex structure, which includes a pyrimidine ring substituted with a bromine atom and various aromatic groups. The presence of the bromine atom typically enhances the compound's reactivity and can influence its biological activity. The phenylmethoxy and phenylmethyl substituents contribute to its lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many organic compounds, the stability, reactivity, and biological activity of 5-Bromo-4-(phenylmethoxy)-N-(phenylmethyl)-2-pyrimidinamine would depend on various factors, including environmental conditions and the presence of other chemical species. Proper handling and safety measures should be observed when working with this compound in a laboratory setting.
Formula:C18H16BrN3O
InChI:InChI=1S/C18H16BrN3O/c19-16-12-21-18(20-11-14-7-3-1-4-8-14)22-17(16)23-13-15-9-5-2-6-10-15/h1-10,12H,11,13H2,(H,20,21,22)
InChI key:InChIKey=OWAQGZVVTHQXOM-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=NC(NCC3=CC=CC=C3)=NC=C2Br
Synonyms:- 2-Pyrimidinamine, 5-bromo-4-(phenylmethoxy)-N-(phenylmethyl)-
- 5-Bromo-4-(phenylmethoxy)-N-(phenylmethyl)-2-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
