CymitQuimica logo

CAS 885952-42-1

:

3-(3,4-Dimethoxyphenyl)-1,2,4-oxadiazole-5-butanoic acid

Description:
3-(3,4-Dimethoxyphenyl)-1,2,4-oxadiazole-5-butanoic acid is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the 3,4-dimethoxyphenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with aromatic structures. The carboxylic acid functional group in its structure suggests potential for hydrogen bonding, which can affect its reactivity and interaction with other molecules. Additionally, the oxadiazole moiety is often associated with various pharmacological activities, making this compound of interest in medicinal chemistry. Its specific applications and biological effects would depend on further studies, including in vitro and in vivo evaluations. Overall, 3-(3,4-Dimethoxyphenyl)-1,2,4-oxadiazole-5-butanoic acid represents a class of compounds that may have significant implications in drug development and material science.
Formula:C14H16N2O5
InChI:InChI=1S/C14H16N2O5/c1-19-10-7-6-9(8-11(10)20-2)14-15-12(21-16-14)4-3-5-13(17)18/h6-8H,3-5H2,1-2H3,(H,17,18)
InChI key:InChIKey=WYCWGRMUWVQULV-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1OC)C=2N=C(CCCC(O)=O)ON2
Synonyms:
  • 3-(3,4-Dimethoxyphenyl)-1,2,4-oxadiazole-5-butanoic acid
  • 1,2,4-Oxadiazole-5-butanoic acid, 3-(3,4-dimethoxyphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.