CymitQuimica logo

CAS 885953-17-3

:

2-Amino-2,3-dihydro-5-nitro-1H-indene-2-carboxylic acid

Description:
2-Amino-2,3-dihydro-5-nitro-1H-indene-2-carboxylic acid is a chemical compound characterized by its unique indene structure, which features a fused ring system. This compound contains an amino group (-NH2), a nitro group (-NO2), and a carboxylic acid group (-COOH), contributing to its potential as a versatile building block in organic synthesis. The presence of the nitro group typically enhances the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and reductions. The amino group can participate in hydrogen bonding and may influence the compound's solubility and interaction with biological systems. Additionally, the carboxylic acid group can act as a proton donor, affecting the compound's acidity and reactivity in different pH environments. Overall, 2-Amino-2,3-dihydro-5-nitro-1H-indene-2-carboxylic acid is of interest in medicinal chemistry and materials science due to its functional groups and structural properties.
Formula:C10H10N2O4
InChI:InChI=1S/C10H10N2O4/c11-10(9(13)14)4-6-1-2-8(12(15)16)3-7(6)5-10/h1-3H,4-5,11H2,(H,13,14)
InChI key:InChIKey=RMJUCYFAZHSRAU-UHFFFAOYSA-N
SMILES:C(O)(=O)C1(N)CC=2C(C1)=CC=C(N(=O)=O)C2
Synonyms:
  • 1H-Indene-2-carboxylic acid, 2-amino-2,3-dihydro-5-nitro-
  • 2-Amino-2,3-dihydro-5-nitro-1H-indene-2-carboxylic acid
  • 2-Amino-5-nitro-2,3-dihydro-1H-indene-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.