CymitQuimica logo

CAS 885953-49-1

:

Propanoic acid, 2-hydroxy-3-methoxy-2-(methoxymethyl)-

Description:
Propanoic acid, 2-hydroxy-3-methoxy-2-(methoxymethyl)-, identified by the CAS number 885953-49-1, is an organic compound characterized by its carboxylic acid functional group, which imparts acidic properties. This compound features multiple functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, contributing to its reactivity and potential solubility in polar solvents. The presence of these groups suggests that it may exhibit hydrogen bonding capabilities, influencing its physical properties such as boiling and melting points. Additionally, the methoxymethyl substituent indicates that the compound may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Its structural complexity may also suggest potential biological activity, making it of interest in medicinal chemistry. However, specific details regarding its toxicity, stability, and reactivity would require further investigation through experimental data and literature. Overall, this compound exemplifies the diverse nature of organic acids and their derivatives in chemical research and applications.
Formula:C6H12O5
InChI:InChI=1S/C6H12O5/c1-10-3-6(9,4-11-2)5(7)8/h9H,3-4H2,1-2H3,(H,7,8)
InChI key:InChIKey=LSNHSXBFJAFJNC-UHFFFAOYSA-N
SMILES:C(COC)(COC)(C(O)=O)O
Synonyms:
  • 2-Hydroxy-3-methoxy-2-methoxymethylpropionic acid
  • 2-Hydroxy-3-methoxy-2-(methoxymethyl)propanoic acid
  • Propanoic acid, 2-hydroxy-3-methoxy-2-(methoxymethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.