CymitQuimica logo

CAS 885953-52-6

:

2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanamine

Description:
2-[3-(4-Methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethanamine, with the CAS number 885953-52-6, is a chemical compound characterized by its unique structure that includes an oxadiazole ring and an ethanamine moiety. The presence of the 4-methoxyphenyl group contributes to its potential as a bioactive molecule, possibly influencing its solubility and interaction with biological targets. This compound may exhibit various properties such as moderate to high polarity due to the functional groups present, which can affect its pharmacokinetics and bioavailability. Additionally, the oxadiazole ring is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's reactivity can be influenced by the amine group, which may participate in hydrogen bonding and other interactions. Overall, the characteristics of this compound suggest it could be of interest in research areas such as drug development, materials science, or organic synthesis, although specific biological activities and applications would require further investigation.
Formula:C11H13N3O2
InChI:InChI=1/C11H13N3O2/c1-15-9-4-2-8(3-5-9)11-13-10(6-7-12)16-14-11/h2-5H,6-7,12H2,1H3
SMILES:COc1ccc(cc1)c1nc(CCN)on1
Synonyms:
  • 1,2,4-Oxadiazole-5-Ethanamine, 3-(4-Methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.