CAS 885953-67-3

2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine

Description:

2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethanamine, with the CAS number 885953-67-3, is a chemical compound characterized by its unique structure that includes an oxadiazole ring and an ethylamine moiety. The presence of the 4-chlorophenyl group contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and may show varying degrees of stability depending on environmental conditions. Its oxadiazole component suggests potential applications in pharmaceuticals, particularly in the development of agents with antimicrobial or anti-inflammatory properties. The compound's reactivity can be influenced by the functional groups present, allowing for further derivatization or modification. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can impart toxicity. Overall, this compound represents a class of heterocyclic compounds that are valuable in research and development within the field of chemistry and drug discovery.

Formula: C₁₀H₁₀ClN₃O

InChI: InChI=1/C10H10ClN3O/c11-8-3-1-7(2-4-8)10-13-9(5-6-12)15-14-10/h1-4H,5-6,12H2

SMILES: c1cc(ccc1c1nc(CCN)on1)Cl

Synonyms:

• 1,2,4-Oxadiazole-5-Ethanamine, 3-(4-Chlorophenyl)-

2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethan-1-amine

CAS: 885953-67-3

Formula: C₁₀H₁₀ClN₃O

Molecular weight: 223.6589

Ref: IN-DA004BLP