CAS 885953-93-5
:(1Z)-2-pyridin-4-ylethanimidamide
Description:
(1Z)-2-pyridin-4-ylethanimidamide, with the CAS number 885953-93-5, is a chemical compound characterized by its unique structural features. It contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, contributing to its basicity and potential for forming hydrogen bonds. The compound features an ethanimidamide functional group, which includes an amine and an imine, indicating its potential reactivity in various chemical reactions. This substance may exhibit properties such as solubility in polar solvents due to the presence of the amine group, and it may participate in hydrogen bonding interactions. Its structural configuration, particularly the (1Z) designation, suggests specific stereochemistry that can influence its biological activity and interactions with other molecules. Compounds like this are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Understanding its characteristics is crucial for exploring its reactivity, stability, and potential uses in various chemical contexts.
Formula:C7H9N3
InChI:InChI=1/C7H9N3/c8-7(9)5-6-1-3-10-4-2-6/h1-4H,5H2,(H3,8,9)
SMILES:c1cnccc1CC(=N)N
Synonyms:- 2-(Pyridin-4-yl)ethanimidamide
- 4-Pyridineethanimidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
