CAS 885953-94-6

7,8-Dimethoxy-1-oxo-2(1H)-phthalazineacetic acid

Description:

7,8-Dimethoxy-1-oxo-2(1H)-phthalazineacetic acid, with the CAS number 885953-94-6, is a chemical compound that belongs to the class of phthalazine derivatives. This substance features a phthalazine core, which is a bicyclic structure containing two fused nitrogen-containing rings. The presence of methoxy groups at the 7 and 8 positions enhances its solubility and may influence its biological activity. The carboxylic acid functional group contributes to its acidity and potential reactivity, making it suitable for various chemical reactions. This compound may exhibit interesting pharmacological properties, potentially acting as a bioactive agent in medicinal chemistry. Its structural characteristics suggest that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its behavior in biological systems. As with many organic compounds, its stability, reactivity, and interactions with other molecules can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in research or industry.

Formula: C₁₂H₁₂N₂O₅

InChI: InChI=1S/C12H12N2O5/c1-18-8-4-3-7-5-13-14(6-9(15)16)12(17)10(7)11(8)19-2/h3-5H,6H2,1-2H3,(H,15,16)

InChI key: InChIKey=PXVBMXPFVIUDQY-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C=NN(CC(O)=O)C2=O)=CC=C1OC

Synonyms:

• 7,8-Dimethoxy-1-oxo-2(1H)-phthalazineacetic acid
• 2(1H)-Phthalazineacetic acid, 7,8-dimethoxy-1-oxo-