CAS 885954-17-6

3,4,5-Trimethoxybenzeneethanimidamide

Description:

3,4,5-Trimethoxybenzeneethanimidamide, identified by its CAS number 885954-17-6, is an organic compound characterized by its unique structure, which includes a benzene ring substituted with three methoxy groups at the 3, 4, and 5 positions, along with an ethanimidamide functional group. This compound is likely to exhibit properties typical of aromatic amides, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of methoxy groups can influence its electronic properties, potentially enhancing its reactivity and solubility in polar solvents. Additionally, the imidamide functional group may impart biological activity, making it of interest in medicinal chemistry. The compound's molecular interactions, including hydrogen bonding and π-π stacking due to the aromatic system, could play a significant role in its behavior in various chemical environments. Overall, 3,4,5-Trimethoxybenzeneethanimidamide represents a complex structure that may have applications in pharmaceuticals or materials science, although specific biological or chemical activities would require further investigation.

Formula: C₁₁H₁₆N₂O₃

InChI: InChI=1S/C11H16N2O3/c1-14-8-4-7(6-10(12)13)5-9(15-2)11(8)16-3/h4-5H,6H2,1-3H3,(H3,12,13)

InChI key: InChIKey=PCYMQPXREDZMEA-UHFFFAOYSA-N

SMILES: O(C)C1=C(OC)C(OC)=CC(CC(=N)N)=C1

Synonyms:

• Benzeneethanimidamide, 3,4,5-trimethoxy-
• 3,4,5-Trimethoxybenzeneethanimidamide