CAS 885955-09-9
:2-Oxo-3-phenyl-1-imidazolidineacetic acid
Description:
2-Oxo-3-phenyl-1-imidazolidineacetic acid is a chemical compound characterized by its imidazolidine structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits properties associated with both acidic and basic functionalities due to the presence of the carboxylic acid group and the imidazolidine moiety. The phenyl group contributes to its aromatic characteristics, potentially influencing its solubility and reactivity. As an imidazolidine derivative, it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may exhibit biological activity. Its specific interactions with biological targets would depend on its stereochemistry and the presence of functional groups. Overall, 2-Oxo-3-phenyl-1-imidazolidineacetic acid represents a versatile scaffold for further chemical exploration and development.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c14-10(15)8-12-6-7-13(11(12)16)9-4-2-1-3-5-9/h1-5H,6-8H2,(H,14,15)
Synonyms:- (2-Oxo-3-phenyl-1-imidazolidinyl)acetic acid
- 2-(2-oxo-3-phenyliMidazolidin-1-yl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

