CAS 885956-82-1
:5-fluoro-2-methylbenzenecarboximidamide
Description:
5-Fluoro-2-methylbenzenecarboximidamide is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a methyl group attached to a benzene ring. The presence of the carboximidamide functional group indicates that it contains both an amine and an imine, contributing to its potential reactivity and biological activity. This compound is likely to exhibit polar characteristics due to the presence of the carboximidamide group, which can engage in hydrogen bonding. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its interaction with biological targets. Additionally, the methyl group may provide steric hindrance, influencing the compound's overall reactivity and stability. Such compounds are often of interest in medicinal chemistry for their potential therapeutic applications, particularly in the development of pharmaceuticals. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization.
Formula:C8H9FN2
InChI:InChI=1/C8H9FN2/c1-5-2-3-6(9)4-7(5)8(10)11/h2-4H,1H3,(H3,10,11)
SMILES:Cc1ccc(cc1C(=N)N)F
Synonyms:- Benzenecarboximidamide, 5-Fluoro-2-Methyl-
- 5-Fluoro-2-methylbenzenecarboximidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-Fluoro-2-methylbenzene-1-carboximidamide
CAS:5-Fluoro-2-methylbenzene-1-carboximidamide
Molecular weight:152.16886g/mol


