
CAS 885957-17-5
:2,6-Dimethoxybenzenecarboximidamide
Description:
2,6-Dimethoxybenzenecarboximidamide is an organic compound characterized by its structure, which features a benzene ring substituted with two methoxy groups at the 2 and 6 positions and a carboximidamide functional group. This compound is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the methoxy groups enhances its electron-donating properties, which can influence its reactivity and interactions in chemical reactions. The carboximidamide functional group contributes to its potential as a ligand in coordination chemistry and may exhibit biological activity, making it of interest in pharmaceutical research. Its CAS number, 885957-17-5, allows for easy identification in chemical databases. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-12-6-4-3-5-7(13-2)8(6)9(10)11/h3-5H,1-2H3,(H3,10,11)
InChI key:InChIKey=FMJAJKTZTXLTGY-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=C(OC)C=CC=C1OC
Synonyms:- 2,6-Dimethoxybenzenecarboximidamide
- Benzenecarboximidamide, 2,6-dimethoxy-
- 2,6-Dimethoxybenzene-1-carboximidamide
- 2,6-Dimethoxy-benzamidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.