CymitQuimica logo

CAS 885957-28-8

:

2,5-Difluorobenzenecarboximidamide

Description:
2,5-Difluorobenzenecarboximidamide is a chemical compound characterized by the presence of a benzene ring substituted with two fluorine atoms at the 2 and 5 positions, along with a carboximidamide functional group. This compound is notable for its potential applications in medicinal chemistry and material science due to the presence of the fluorine atoms, which can enhance biological activity and influence the compound's physical properties. The carboximidamide group contributes to its reactivity and may participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. The presence of fluorine typically increases the lipophilicity and metabolic stability of the compound, making it of interest in drug design. Additionally, the compound's structure suggests it may exhibit unique electronic properties due to the electron-withdrawing nature of the fluorine atoms. Overall, 2,5-Difluorobenzenecarboximidamide is a versatile compound with potential implications in various fields of chemistry and pharmacology.
Formula:C7H6F2N2
InChI:InChI=1S/C7H6F2N2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,(H3,10,11)
InChI key:InChIKey=USLJPLCTOMDPMF-UHFFFAOYSA-N
SMILES:C(=N)(N)C1=C(F)C=CC(F)=C1
Synonyms:
  • 2,5-Difluoro-Benzamidine Hydrochloride
  • 2,5-Difluoro-benzamidine
  • 2,5-Difluorobenzenecarboximidamide
  • Benzenecarboximidamide, 2,5-difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.