
CAS 885957-33-5
:3-Ethoxybenzeneethanimidamide
Description:
3-Ethoxybenzeneethanimidamide, identified by its CAS number 885957-33-5, is an organic compound characterized by the presence of an ethoxy group and an ethanimidamide functional group attached to a benzene ring. This compound typically exhibits properties associated with both aromatic and amide functionalities, which may influence its solubility, reactivity, and potential applications. The ethoxy group contributes to its hydrophobic characteristics, while the ethanimidamide moiety may impart biological activity or reactivity in various chemical reactions. The compound's structure suggests it could participate in hydrogen bonding due to the amide functionality, which may affect its physical properties such as melting point and boiling point. Additionally, the presence of the benzene ring indicates potential for electrophilic substitution reactions. Overall, 3-Ethoxybenzeneethanimidamide may be of interest in medicinal chemistry or materials science, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C10H14N2O
InChI:InChI=1S/C10H14N2O/c1-2-13-9-5-3-4-8(6-9)7-10(11)12/h3-6H,2,7H2,1H3,(H3,11,12)
InChI key:InChIKey=ILPQCODZEJJZON-UHFFFAOYSA-N
SMILES:C(C(=N)N)C1=CC(OCC)=CC=C1
Synonyms:- Benzeneethanimidamide, 3-ethoxy-
- 2-(3-Ethoxyphenyl)ethanimidamide
- 3-Ethoxybenzeneethanimidamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.