CAS 885958-47-4

Hexahydro-2-(phenylmethyl)cyclopenta[c]pyrrole-3a(1H)-carboxylic acid

Description:

Hexahydro-2-(phenylmethyl)cyclopenta[c]pyrrole-3a(1H)-carboxylic acid, with the CAS number 885958-47-4, is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopentane ring fused to a pyrrole moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity. The presence of the phenylmethyl group enhances its lipophilicity, which may influence its solubility and interaction with biological systems. The hexahydro configuration indicates that the compound is fully saturated, which can affect its stability and reactivity compared to unsaturated analogs. Such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. However, specific biological activities, toxicity, and applications would require further investigation through empirical studies. Overall, the structural characteristics of this compound suggest potential utility in various chemical and pharmaceutical applications, warranting further exploration in research settings.

Formula: C₁₅H₁₉NO₂

InChI: InChI=1S/C15H19NO2/c17-14(18)15-8-4-7-13(15)10-16(11-15)9-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,17,18)

InChI key: InChIKey=NRQNCWGEIKPPEQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C12C(CN(CC3=CC=CC=C3)C1)CCC2

Synonyms:

• Hexahydro-2-(phenylmethyl)cyclopenta[c]pyrrole-3a(1H)-carboxylic acid
• Cyclopenta[c]pyrrole-3a(1H)-carboxylic acid, hexahydro-2-(phenylmethyl)-