CAS 885959-24-0
:2-methyloctahydro-1H-pyrrolo[3,4-c]pyridine
Description:
2-Methyloctahydro-1H-pyrrolo[3,4-c]pyridine is a bicyclic organic compound characterized by its unique fused ring structure, which includes a pyrrolidine and a piperidine moiety. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its structural similarity to biologically active compounds. The presence of the methylene and methyl groups contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Additionally, the compound may exhibit various functional properties, such as basicity, due to the nitrogen atoms in its ring structure. Its synthesis often involves multi-step organic reactions, and it may be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. As with many nitrogen-containing heterocycles, it may also display interesting biological activities, making it a subject of interest in drug discovery research.
Formula:C8H16N2
InChI:InChI=1/C8H16N2/c1-10-5-7-2-3-9-4-8(7)6-10/h7-9H,2-6H2,1H3
SMILES:CN1CC2CCNCC2C1
Synonyms:- 1H-pyrrolo[3,4-c]pyridine, octahydro-2-methyl-
- 2-Methyloctahydro-1H-pyrrolo[3,4-c]pyridine
- 2-METHYL-OCTAHYDRO-PYRROLO[3,4-C]PYRIDINE
- Octahydro-2-methyl-1H-pyrrolo[3,4-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
