CymitQuimica logo

CAS 88596-30-9

:

1-(3,4-Dihydroxyphenyl)-3-phenyl-2-propen-1-one

Description:
1-(3,4-Dihydroxyphenyl)-3-phenyl-2-propen-1-one, also known as a derivative of chalcone, is an organic compound characterized by its structure, which features a phenyl group and a dihydroxy-substituted phenyl moiety connected by a propenone linkage. This compound typically exhibits a yellow to orange color and is known for its potential biological activities, including antioxidant, anti-inflammatory, and anticancer properties. The presence of hydroxyl groups enhances its reactivity and solubility in polar solvents, while the conjugated double bond system contributes to its UV-Vis absorbance characteristics. It may also participate in various chemical reactions, such as Michael addition and aldol condensation, due to its electrophilic nature. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-(3,4-Dihydroxyphenyl)-3-phenyl-2-propen-1-one is of interest in both synthetic organic chemistry and medicinal chemistry for its diverse applications.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c16-13(8-6-11-4-2-1-3-5-11)12-7-9-14(17)15(18)10-12/h1-10,17-18H
InChI key:InChIKey=WYUBYHGDUPOTPG-UHFFFAOYSA-N
SMILES:C(C=CC1=CC=CC=C1)(=O)C2=CC(O)=C(O)C=C2
Synonyms:
  • 2-Propen-1-one, 1-(3,4-dihydroxyphenyl)-3-phenyl-
  • 1-(3,4-Dihydroxyphenyl)-3-phenyl-2-propen-1-one
  • 3′,4′-Dihydroxychalcone
  • Chalcone, 3′,4′-dihydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.