CAS 885963-50-8

3′,5′-Difluoro[1,1′-biphenyl]-4-methanol

Description:

3′,5′-Difluoro[1,1′-biphenyl]-4-methanol, with the CAS number 885963-50-8, is an organic compound characterized by its biphenyl structure substituted with two fluorine atoms and a hydroxymethyl group. The presence of the difluoro substituents at the 3′ and 5′ positions of the biphenyl ring significantly influences its chemical properties, including its reactivity and polarity. The hydroxymethyl group at the 4-position enhances its solubility in polar solvents and may participate in hydrogen bonding, affecting its interactions in various chemical environments. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and materials science. Additionally, the fluorine atoms can impart unique electronic properties, potentially affecting the compound's stability and reactivity. Overall, 3′,5′-Difluoro[1,1′-biphenyl]-4-methanol is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₃H₁₀F₂O

InChI: InChI=1S/C13H10F2O/c14-12-5-11(6-13(15)7-12)10-3-1-9(8-16)2-4-10/h1-7,16H,8H2

InChI key: InChIKey=ZXSVUJOHOVCESC-UHFFFAOYSA-N

SMILES: FC=1C=C(C=C(F)C1)C2=CC=C(CO)C=C2

Synonyms:

• 3′,5′-Difluoro[1,1′-biphenyl]-4-methanol
• 4-(2,6-Difluorophenyl)benzyl alcohol
• 4-(3,5-Difluorophenyl)benzyl alcohol
• [1,1′-Biphenyl]-4-methanol, 3′,5′-difluoro-

(3',5'-Difluoro-[1,1'-biphenyl]-4-yl)methanol

CAS: 885963-50-8

Formula: C₁₃H₁₀F₂O

Molecular weight: 220.2147

Ref: IN-DA004AZX