CymitQuimica logo

CAS 885963-71-3

:

2-chloro-4-fluoro-N'-hydroxybenzenecarboximidamide

Description:
2-Chloro-4-fluoro-N'-hydroxybenzenecarboximidamide, with the CAS number 885963-71-3, is a chemical compound characterized by its unique functional groups and structural features. It contains a benzene ring substituted with a chlorine atom and a fluorine atom, which contribute to its reactivity and potential biological activity. The presence of the N'-hydroxy group indicates that it has an amide functional group, which can participate in hydrogen bonding and may influence its solubility and interaction with biological targets. This compound is likely to exhibit properties typical of halogenated aromatic compounds, such as increased lipophilicity and potential for metabolic transformation. Its specific applications may vary, but compounds of this nature are often investigated for their roles in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of both halogen substituents and the hydroxy group suggests that it may have interesting electronic properties, which could be relevant in various chemical reactions or biological interactions.
Formula:C7H6ClFN2O
InChI:InChI=1/C7H6ClFN2O/c8-6-3-4(9)1-2-5(6)7(10)11-12/h1-3,12H,(H2,10,11)
SMILES:c1cc(c(cc1F)Cl)C(=N)NO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.