CymitQuimica logo

CAS 885965-89-9

:

(1Z)-2-(3,4-difluorophenyl)ethanimidamide

Description:
(1Z)-2-(3,4-difluorophenyl)ethanimidamide is a chemical compound characterized by its unique structural features, including an ethanimidamide backbone and a substituted phenyl group. The presence of two fluorine atoms on the phenyl ring significantly influences its chemical properties, including its reactivity and polarity. This compound typically exhibits a planar structure due to the conjugation between the imidamide and the aromatic system, which can enhance its stability and interaction with biological targets. The (1Z) designation indicates a specific geometric configuration around the double bond, which can affect its biological activity and binding affinity in pharmacological contexts. As a result, compounds like this are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Additionally, the presence of fluorine atoms can improve metabolic stability and lipophilicity, making such compounds of interest in drug design and development.
Formula:C8H8F2N2
InChI:InChI=1/C8H8F2N2/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3H,4H2,(H3,11,12)
SMILES:c1cc(c(cc1CC(=N)N)F)F
Synonyms:
  • 2-(3,4-Difluorophenyl)ethanimidamide
  • Benzeneethanimidamide, 3,4-Difluoro-
  • 3,4-difluoro-Benzeneethanimidamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.