CAS 88599-41-1
:1-methylethyl 2-(carbamoyloxy)benzoate
Description:
1-Methylethyl 2-(carbamoyloxy)benzoate, also known by its CAS number 88599-41-1, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and an amide. This compound features a benzoate moiety with a carbamoyloxy substituent at the ortho position relative to the ester group. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the carbamoyloxy group suggests potential applications in medicinal chemistry, particularly in drug design, as it may enhance solubility and bioavailability. The compound's molecular structure indicates it may exhibit moderate polarity, influencing its solubility in various organic solvents. Additionally, it may participate in hydrogen bonding due to the carbamoyloxy group, which can affect its reactivity and interactions with biological systems. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C11H13NO4
InChI:InChI=1/C11H13NO4/c1-7(2)15-10(13)8-5-3-4-6-9(8)16-11(12)14/h3-7H,1-2H3,(H2,12,14)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzoic acid,2-[(aminocarbonyl)oxy]-, 1-methylethyl ester
CAS:Formula:C11H13NO4Molecular weight:223.2252
