CAS 886-51-1
:Methyl 3,5-dimethoxybenzenepropanoate
Description:
Methyl 3,5-dimethoxybenzenepropanoate, with the CAS number 886-51-1, is an organic compound characterized by its ester functional group. It features a propanoate moiety attached to a benzene ring that is further substituted with two methoxy groups at the 3 and 5 positions. This structure contributes to its aromatic properties and influences its reactivity and solubility. The presence of methoxy groups enhances the compound's electron-donating characteristics, which can affect its chemical behavior in various reactions, such as electrophilic aromatic substitution. Methyl 3,5-dimethoxybenzenepropanoate is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in fragrance applications. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic aromatic structure. The compound may be used in synthetic organic chemistry as an intermediate for the production of more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C12H16O4
InChI:InChI=1S/C12H16O4/c1-14-10-6-9(4-5-12(13)16-3)7-11(8-10)15-2/h6-8H,4-5H2,1-3H3
InChI key:InChIKey=ODWCJVBYGGXGSO-UHFFFAOYSA-N
SMILES:C(CC(OC)=O)C1=CC(OC)=CC(OC)=C1
Synonyms:- Benzenepropanoic acid, 3,5-dimethoxy-, methyl ester
- Methyl 3-(3,5-dimethoxyphenyl)propionate
- Hydrocinnamic acid, 3,5-dimethoxy-, methyl ester
- Methyl 3,5-dimethoxybenzenepropanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
3-(3,5-Dimethoxyphenyl)propionic acid methyl ester
CAS:<p>3-(3,5-Dimethoxyphenyl)propionic acid methyl ester is a reagent that is used as a reactant in organic synthesis. It is also useful as a scaffold for the synthesis of heterocycles and other complex compounds. 3-(3,5-Dimethoxyphenyl)propionic acid methyl ester is used in research chemical synthesis and as a versatile building block for the production of fine chemicals. This chemical can be used to create products such as pharmaceuticals, pesticides, and cosmetics.</p>Formula:C12H16O4Purity:Min. 95%Molecular weight:224.25 g/mol
