CAS 886-66-8
:1,4-Diphenyl-1,3-butadiyne
Description:
1,4-Diphenyl-1,3-butadiyne is an organic compound characterized by its linear structure featuring two phenyl groups attached to a butadiyne backbone. This compound belongs to the class of alkynes, specifically conjugated alkynes, due to the presence of alternating double and triple bonds. It is typically a solid at room temperature and exhibits a high degree of stability due to the resonance stabilization provided by the phenyl groups. The compound is known for its unique optical and electronic properties, making it of interest in materials science and organic electronics. Its synthesis often involves coupling reactions, and it can be used as a precursor for various organic synthesis applications. 1,4-Diphenyl-1,3-butadiyne is also notable for its potential applications in the development of organic semiconductors and as a building block in the synthesis of more complex organic molecules. However, handling precautions should be observed due to its potential toxicity and reactivity.
Formula:C16H10
InChI:InChI=1S/C16H10/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12H
InChI key:InChIKey=HMQFJYLWNWIYKQ-UHFFFAOYSA-N
SMILES:C(#CC#CC1=CC=CC=C1)C2=CC=CC=C2
Synonyms:- 1,1′-(1,3-Butadiyne-1,4-diyl)bis[benzene]
- Butadiyne, diphenyl-
- Diphenylbutadiyne
- Diphenyldiacetylene
- Benzene, 1,1′-(1,3-butadiyne-1,4-diyl)bis-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
1,4-Diphenylbutadiyne
CAS:Formula:C16H10Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:202.261,4-Diphenylbutadiyne, 99%
CAS:1,4-Diphenylbutadiyne was used in the preparation of 7,8-dehydropurpurin dimers via two-fold Pd-catalyzed [3+2] annulation of meso-bromoporphyrin. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refeFormula:C16H10Purity:99%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:202.261,4-Diphenylbutadiyne
CAS:1,4-Diphenylbutadiyne is a conjugated diyne and aromatic compound widely used in biochemical experiments and drug synthesis research.Formula:C16H10Color and Shape:SolidMolecular weight:202.251,4-Diphenylbutadiyne
CAS:Formula:C16H10Purity:≥ 98.5%Color and Shape:White to off-white powderMolecular weight:202.251,4-Diphenylbutadiyne
CAS:1,4-Diphenylbutadiyne is a chemical compound that has been used in fluorescence studies. It is insoluble in water and can be used as a polymer with high values. 1,4-Diphenylbutadiyne reacts with sodium carbonate to form the light emitting compound dimethyl fumarate. This reaction mechanism is due to the formation of an intramolecular hydrogen bond between the carbonyl group and one of the phenyl groups. The basic structure of this molecule is made up of nitrogen atoms that are arranged in a planar fashion. The molecule has high resistance to heat and oxidation, making it useful as a solid catalyst for reactions involving organic compounds.
Formula:C16H10Purity:Min. 95%Molecular weight:202.25 g/mol1,4-Diphenylbutadiyne
CAS:Formula:C16H10Purity:98%Color and Shape:Solid, No data available.Molecular weight:202.256








