CymitQuimica logo

CAS 88606-97-7

:

1-(2-Ethyl-1-oxohexyl)hexahydro-2H-azepin-2-one

Description:
1-(2-Ethyl-1-oxohexyl)hexahydro-2H-azepin-2-one, with the CAS number 88606-97-7, is a chemical compound characterized by its unique structure that includes a hexahydro-azepin ring and an oxohexyl substituent. This compound typically exhibits properties associated with cyclic amides, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the ethyl and oxo groups suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. Its molecular structure may impart specific biological activities, making it of interest in pharmaceutical or agrochemical applications. Additionally, the compound's physical properties, such as boiling point, melting point, and density, would depend on its molecular interactions and the presence of functional groups. As with many organic compounds, safety data should be consulted to understand its handling, toxicity, and environmental impact. Overall, this compound represents a class of substances with potential utility in various chemical and industrial applications.
Formula:C14H25NO2
InChI:InChI=1S/C14H25NO2/c1-3-5-9-12(4-2)14(17)15-11-8-6-7-10-13(15)16/h12H,3-11H2,1-2H3
InChI key:InChIKey=WGAJVDLUQMMHBO-UHFFFAOYSA-N
SMILES:C(C(CCCC)CC)(=O)N1C(=O)CCCCC1
Synonyms:
  • 1-(2-Ethyl-1-oxohexyl)hexahydro-2H-azepin-2-one
  • 2H-Azepin-2-one, 1-(2-ethyl-1-oxohexyl)hexahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.