CAS 88607-79-8
:(E)-3-(4-benzyloxyphenyl)-1-(2,4-dibenzyloxy-6-hydroxy-phenyl)prop-2-en-1-one
Description:
The chemical substance known as (E)-3-(4-benzyloxyphenyl)-1-(2,4-dibenzyloxy-6-hydroxy-phenyl)prop-2-en-1-one, with the CAS number 88607-79-8, is a synthetic organic compound characterized by its complex structure featuring multiple aromatic rings and functional groups. This compound belongs to the class of chalcones, which are known for their conjugated double bond systems that contribute to their reactivity and potential biological activity. The presence of benzyloxy groups enhances its lipophilicity, potentially affecting its solubility and interaction with biological membranes. The hydroxyl group in the structure may impart antioxidant properties, while the overall configuration suggests that it could exhibit various pharmacological activities, including anti-inflammatory or anticancer effects. The (E) configuration indicates that the double bond between the propene and carbonyl groups is in the trans orientation, which can influence the compound's stability and reactivity. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and material science.
Formula:C36H30O5
InChI:InChI=1/C36H30O5/c37-33(21-18-27-16-19-31(20-17-27)39-24-28-10-4-1-5-11-28)36-34(38)22-32(40-25-29-12-6-2-7-13-29)23-35(36)41-26-30-14-8-3-9-15-30/h1-23,38H,24-26H2/b21-18+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
E-3-(4-Benzyloxy)-1-(2.4-bisbenzyloxy-6-hydroxy)phenyl)propenone
CAS:Formula:C36H30O5Color and Shape:SolidMolecular weight:542.6204E-3-(4-Benzyloxy)-1-(2.4-bisbenzyloxy-6-hydroxy)phenyl)propenone
CAS:Controlled ProductApplications E-3-(4-Benzyloxy)-1-(2.4-bisbenzyloxy-6-hydroxy)phenyl)propenone (cas# 88607-79-8) is a compound useful in organic synthesis.
Formula:C36H30O5Color and Shape:NeatMolecular weight:542.62

