CAS 88609-22-7
:8-Azido-6-nitroquinoline
Description:
8-Azido-6-nitroquinoline is a chemical compound characterized by its unique structure, which includes a quinoline ring substituted with both an azido group and a nitro group. The azido group (-N3) is known for its reactivity, particularly in click chemistry and as a potential precursor for various nitrogen-containing compounds. The nitro group (-NO2) contributes to the compound's electron-withdrawing properties, which can influence its reactivity and stability. This compound is typically used in research settings, particularly in the fields of organic synthesis and materials science, due to its potential applications in the development of new materials or as a fluorescent probe. Its properties may include moderate solubility in organic solvents and stability under certain conditions, although the presence of the azido group may render it sensitive to heat or shock. Safety precautions are essential when handling this compound, as azides can be hazardous. Overall, 8-Azido-6-nitroquinoline serves as an interesting subject for further exploration in chemical research.
Formula:C9H5N5O2
InChI:InChI=1S/C9H5N5O2/c10-13-12-8-5-7(14(15)16)4-6-2-1-3-11-9(6)8/h1-5H
InChI key:InChIKey=NYBDRMSWBYKIKO-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C=1C2=C(C=C(N(=O)=O)C1)C=CC=N2
Synonyms:- Quinoline, 8-azido-6-nitro-
- 8-Azido-6-nitroquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
