CAS 88619-33-4
:3-Methyl-6-nitro-2,4(1H,3H)-quinazolinedione
Description:
3-Methyl-6-nitro-2,4(1H,3H)-quinazolinedione, with the CAS number 88619-33-4, is a heterocyclic organic compound characterized by its quinazoline core structure, which features a fused bicyclic system containing both benzene and pyrimidine rings. This compound typically exhibits a yellow to orange crystalline appearance and is known for its nitro and methyl substituents, which influence its chemical reactivity and properties. The presence of the nitro group often imparts significant polarity and can enhance the compound's ability to participate in electrophilic reactions. Additionally, the methyl group can affect the compound's solubility and stability. 3-Methyl-6-nitro-2,4(1H,3H)-quinazolinedione may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. As with many nitro-containing compounds, it is essential to handle this substance with care, considering its potential toxicity and environmental impact. Proper safety protocols should be followed when working with this compound in laboratory settings.
Formula:C9H7N3O4
InChI:InChI=1S/C9H7N3O4/c1-11-8(13)6-4-5(12(15)16)2-3-7(6)10-9(11)14/h2-4H,1H3,(H,10,14)
InChI key:InChIKey=RCCWMPQIHDYYSF-UHFFFAOYSA-N
SMILES:O=C1C=2C(NC(=O)N1C)=CC=C(N(=O)=O)C2
Synonyms:- 2,4(1H,3H)-Quinazolinedione, 3-methyl-6-nitro-
- 3-Methyl-6-nitro-2,4(1H,3H)-quinazolinedione
- 3-Methyl-6-nitro-1H-quinazoline-2,4-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
