CAS 886215-55-0

methyl (2S)-2-amino-3-[6-(trifluoromethyl)-3-pyridyl]propanoate

Description:

Methyl (2S)-2-amino-3-[6-(trifluoromethyl)-3-pyridyl]propanoate is an organic compound characterized by its amino acid structure, featuring a methyl ester functional group. This compound contains a chiral center at the second carbon, indicating that it exists in a specific stereoisomeric form (the S configuration). The presence of a trifluoromethyl group attached to a pyridine ring enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The pyridine moiety contributes to the compound's aromatic character, while the amino and ester functionalities suggest potential for interactions in biological systems, such as enzyme binding or receptor activity. Its CAS number, 886215-55-0, allows for precise identification in chemical databases. Overall, this compound's unique structural features may provide insights into its reactivity, solubility, and potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₀H₁₁F₃N₂O₂

InChI: InChI=1/C10H11F3N2O2/c1-17-9(16)7(14)4-6-2-3-8(15-5-6)10(11,12)13/h2-3,5,7H,4,14H2,1H3/t7-/m0/s1

SMILES: COC(=O)[C@H](Cc1ccc(C(F)(F)F)nc1)N