
CAS 886216-65-5
:2-Butanamine, 1-fluoro-3,3-dimethyl-, hydrochloride (1:1), (2S)-
Description:
2-Butanamine, 1-fluoro-3,3-dimethyl-, hydrochloride (1:1), (2S)- is a chiral amine compound characterized by its specific stereochemistry and functional groups. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. The presence of a fluorine atom in its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the unique electronic and steric properties imparted by fluorine. The compound features a butanamine backbone, indicating it has an amine functional group, which can participate in hydrogen bonding and influence its reactivity and interaction with biological systems. Its chirality (2S) indicates that it exists as one specific enantiomer, which can have distinct biological activities compared to its mirror image. Overall, this compound's characteristics make it of interest in various fields, including organic synthesis and drug development, where the precise arrangement of atoms can significantly affect the compound's properties and efficacy.
Formula:C6H14FN·ClH
InChI:InChI=1S/C6H14FN.ClH/c1-6(2,3)5(8)4-7;/h5H,4,8H2,1-3H3;1H/t5-;/m1./s1
InChI key:InChIKey=QNPFAJPALFGGCY-NUBCRITNSA-N
SMILES:[C@H](C(C)(C)C)(CF)N.Cl
Synonyms:- 2-Butanamine, 1-fluoro-3,3-dimethyl-, hydrochloride (1:1), (2S)-
- 2-Butanamine, 1-fluoro-3,3-dimethyl-, hydrochloride, (2S)-
- (S)-1-Fluoro-3,3-dimethylbutan-2-amine hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.